C26H28N6OS — CID 176963623
N'-[4-[[5-[2-(cyclohexylamino)pyrimidin-4-yl]-1,3-thiazol-4-yl]oxy]naphthalen-1-yl]-N,N-dimethylmethanimidamide (PubChem CID 176963623) has the molecular formula C26H28N6OS and a molecular weight of 472.62 g/mol. Its IUPAC name is N'-[4-[[5-[2-(cyclohexylamino)pyrimidin-4-yl]-1,3-thiazol-4-yl]oxy]naphthalen-1-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-[[5-[2-(cyclohexylamino)pyrimidin-4-yl]-1,3-thiazol-4-yl]oxy]naphthalen-1-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 176963623 |
| Molecular Formula | C26H28N6OS |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N'-[4-[[5-[2-(cyclohexylamino)pyrimidin-4-yl]-1,3-thiazol-4-yl]oxy]naphthalen-1-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1ccc(Oc2ncsc2-c2ccnc(NC3CCCCC3)n2)c2ccccc12 |
| InChI | InChI=1S/C26H28N6OS/c1-32(2)16-28-21-12-13-23(20-11-7-6-10-19(20)21)33-25-24(34-17-29-25)22-14-15-27-26(31-22)30-18-8-4-3-5-9-18/h6-7,10-18H,3-5,8-9H2,1-2H3,(H,27,30,31)/b28-16+ |
| InChIKey | UEXNNEJEHFCQBM-LQKURTRISA-N |
| XLogP | 6.51 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|