C11H17N5O4 — CID 176964247
3-[(2R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-methyl-4-(methylideneamino)-2-oxo-1H-imidazole-5-carboximidamide (PubChem CID 176964247) has the molecular formula C11H17N5O4 and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-[(2R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-methyl-4-(methylideneamino)-2-oxo-1H-imidazole-5-carboximidamide.
| Compound Name | 3-[(2R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-methyl-4-(methylideneamino)-2-oxo-1H-imidazole-5-carboximidamide |
|---|---|
| PubChem CID | 176964247 |
| Molecular Formula | C11H17N5O4 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 3-[(2R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-N'-methyl-4-(methylideneamino)-2-oxo-1H-imidazole-5-carboximidamide |
| SMILES | C=Nc1c(/C(N)=N/C)[nH]c(=O)n1[C@H]1CC(O)C(CO)O1 |
| InChI | InChI=1S/C11H17N5O4/c1-13-9(12)8-10(14-2)16(11(19)15-8)7-3-5(18)6(4-17)20-7/h5-7,17-18H,2-4H2,1H3,(H2,12,13)(H,15,19)/t5?,6?,7-/m1/s1 |
| InChIKey | CCWCYPQGPINDRV-KPGICGJXSA-N |
| XLogP | -1.52 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|