C23H24F2N4O — CID 176964421
8-fluoro-3-[3-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]cyclopentyl]-2H-isoquinolin-1-one (PubChem CID 176964421) has the molecular formula C23H24F2N4O and a molecular weight of 410.47 g/mol. Its IUPAC name is 8-fluoro-3-[3-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]cyclopentyl]-2H-isoquinolin-1-one.
| Compound Name | 8-fluoro-3-[3-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]cyclopentyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 176964421 |
| Molecular Formula | C23H24F2N4O |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 8-fluoro-3-[3-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]cyclopentyl]-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]c(C2CCC(N3CCN(c4ccc(F)cn4)CC3)C2)cc2cccc(F)c12 |
| InChI | InChI=1S/C23H24F2N4O/c24-17-5-7-21(26-14-17)29-10-8-28(9-11-29)18-6-4-15(12-18)20-13-16-2-1-3-19(25)22(16)23(30)27-20/h1-3,5,7,13-15,18H,4,6,8-12H2,(H,27,30) |
| InChIKey | YMXZKSRBJIVGKL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |