C24H37FN4O2 — CID 176964696
5-[4-(3-tert-butylcyclopentyl)piperazin-1-yl]-6-fluoro-N-(oxan-4-yl)pyridine-2-carboxamide (PubChem CID 176964696) has the molecular formula C24H37FN4O2 and a molecular weight of 432.58 g/mol. Its IUPAC name is 5-[4-(3-tert-butylcyclopentyl)piperazin-1-yl]-6-fluoro-N-(oxan-4-yl)pyridine-2-carboxamide.
| Compound Name | 5-[4-(3-tert-butylcyclopentyl)piperazin-1-yl]-6-fluoro-N-(oxan-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 176964696 |
| Molecular Formula | C24H37FN4O2 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 5-[4-(3-tert-butylcyclopentyl)piperazin-1-yl]-6-fluoro-N-(oxan-4-yl)pyridine-2-carboxamide |
| SMILES | CC(C)(C)C1CCC(N2CCN(c3ccc(C(=O)NC4CCOCC4)nc3F)CC2)C1 |
| InChI | InChI=1S/C24H37FN4O2/c1-24(2,3)17-4-5-19(16-17)28-10-12-29(13-11-28)21-7-6-20(27-22(21)25)23(30)26-18-8-14-31-15-9-18/h6-7,17-19H,4-5,8-16H2,1-3H3,(H,26,30) |
| InChIKey | DIKRKDLZBGUBNM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|