C16H26KN4OS- — CID 176964697
potassium;5-(4-cyclopentylpiperazin-1-yl)-N-methyl-1,3-thiazole-2-carboxamide;ethane (PubChem CID 176964697) has the molecular formula C16H26KN4OS- and a molecular weight of 361.58 g/mol. Its IUPAC name is potassium;5-(4-cyclopentylpiperazin-1-yl)-N-methyl-1,3-thiazole-2-carboxamide;ethane.
| Compound Name | potassium;5-(4-cyclopentylpiperazin-1-yl)-N-methyl-1,3-thiazole-2-carboxamide;ethane |
|---|---|
| PubChem CID | 176964697 |
| Molecular Formula | C16H26KN4OS- |
| Molecular Weight | 361.58 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | potassium;5-(4-cyclopentylpiperazin-1-yl)-N-methyl-1,3-thiazole-2-carboxamide;ethane |
| SMILES | CNC(=O)c1ncc(N2CCN([C@H]3C[CH-]CC3)CC2)s1.[CH2-]C.[K+] |
| InChI | InChI=1S/C14H21N4OS.C2H5.K/c1-15-13(19)14-16-10-12(20-14)18-8-6-17(7-9-18)11-4-2-3-5-11;1-2;/h2,10-11H,3-9H2,1H3,(H,15,19);1H2,2H3;/q2*-1;+1/t11-;;/m0../s1 |
| InChIKey | FGZDLBYNJGYVHU-IDMXKUIJSA-N |
| XLogP | -0.77 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.58 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|