About (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate
(Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate (PubChem CID 176965612) has the molecular formula C15H34N2O2
and a molecular weight of 274.45 g/mol. Its IUPAC name is (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate.
Molecular Properties
| Compound Name | (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate |
| PubChem CID | 176965612 |
| Molecular Formula | C15H34N2O2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.26 |
| IUPAC Name | (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate |
| SMILES | CCCCN(CC/C=C\COC)C[C@@H]1CCCN1.O.[H][H] |
| InChI | InChI=1S/C15H30N2O.H2O.H2/c1-3-4-11-17(12-6-5-7-13-18-2)14-15-9-8-10-16-15;;/h5,7,15-16H,3-4,6,8-14H2,1-2H3;1H2;1H/b7-5-;;/t15-;;/m0../s1 |
| InChIKey | VGTACRQJRQPLAO-WDBGNIJZSA-N |
| XLogP | 1.85 |
| TPSA | 56.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate?
The IUPAC name of (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate (CID 176965612) is (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate.
What is the SMILES notation for (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate?
The canonical SMILES for (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate is CCCCN(CC/C=C\COC)C[C@@H]1CCCN1.O.[H][H].
What is the InChIKey of (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate?
The InChIKey is VGTACRQJRQPLAO-WDBGNIJZSA-N. The full InChI is InChI=1S/C15H30N2O.H2O.H2/c1-3-4-11-17(12-6-5-7-13-18-2)14-15-9-8-10-16-15;;/h5,7,15-16H,3-4,6,8-14H2,1-2H3;1H2;1H/b7-5-;;/t15-;;/m0../s1.
What are the key properties of (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate?
(Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate has a molecular weight of 274.45 g/mol, XLogP of 1.85, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-butyl-5-methoxy-N-[[(2S)-pyrrolidin-2-yl]methyl]pent-3-en-1-amine;molecular hydrogen;hydrate is sourced from PubChem (CID 176965612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).