C24H27N5O4S — CID 176965946
6-N-(5-cyclopropyl-1-ethylpyrazol-3-yl)-3-N-(2,6-dimethoxyphenyl)sulfanyl-5-methoxy-1,2-benzoxazole-3,6-diamine (PubChem CID 176965946) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is 6-N-(5-cyclopropyl-1-ethylpyrazol-3-yl)-3-N-(2,6-dimethoxyphenyl)sulfanyl-5-methoxy-1,2-benzoxazole-3,6-diamine.
| Compound Name | 6-N-(5-cyclopropyl-1-ethylpyrazol-3-yl)-3-N-(2,6-dimethoxyphenyl)sulfanyl-5-methoxy-1,2-benzoxazole-3,6-diamine |
|---|---|
| PubChem CID | 176965946 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 6-N-(5-cyclopropyl-1-ethylpyrazol-3-yl)-3-N-(2,6-dimethoxyphenyl)sulfanyl-5-methoxy-1,2-benzoxazole-3,6-diamine |
| SMILES | CCn1nc(Nc2cc3onc(NSc4c(OC)cccc4OC)c3cc2OC)cc1C1CC1 |
| InChI | InChI=1S/C24H27N5O4S/c1-5-29-17(14-9-10-14)13-22(26-29)25-16-12-20-15(11-21(16)32-4)24(27-33-20)28-34-23-18(30-2)7-6-8-19(23)31-3/h6-8,11-14H,5,9-10H2,1-4H3,(H,25,26)(H,27,28) |
| InChIKey | IIIUNELMRIUVED-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|