C23H28FN7O3 — CID 176966473
N'-[(1E,4Z)-5-amino-2-methoxy-3-methylidene-4-(methyliminomethyl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]penta-1,4-dienyl]-N-(6-fluoro-1,3-benzodioxol-5-yl)-N-methylethanimidamide (PubChem CID 176966473) has the molecular formula C23H28FN7O3 and a molecular weight of 469.52 g/mol. Its IUPAC name is N'-[(1E,4Z)-5-amino-2-methoxy-3-methylidene-4-(methyliminomethyl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]penta-1,4-dienyl]-N-(6-fluoro-1,3-benzodioxol-5-yl)-N-methylethanimidamide.
| Compound Name | N'-[(1E,4Z)-5-amino-2-methoxy-3-methylidene-4-(methyliminomethyl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]penta-1,4-dienyl]-N-(6-fluoro-1,3-benzodioxol-5-yl)-N-methylethanimidamide |
|---|---|
| PubChem CID | 176966473 |
| Molecular Formula | C23H28FN7O3 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | N'-[(1E,4Z)-5-amino-2-methoxy-3-methylidene-4-(methyliminomethyl)-1-[(5-methyl-1H-pyrazol-3-yl)amino]penta-1,4-dienyl]-N-(6-fluoro-1,3-benzodioxol-5-yl)-N-methylethanimidamide |
| SMILES | C=C(C(=C/N)/C=N/C)/C(OC)=C(\N=C(/C)N(C)c1cc2c(cc1F)OCO2)Nc1cc(C)[nH]n1 |
| InChI | InChI=1S/C23H28FN7O3/c1-13-7-21(30-29-13)28-23(22(32-6)14(2)16(10-25)11-26-4)27-15(3)31(5)18-9-20-19(8-17(18)24)33-12-34-20/h7-11H,2,12,25H2,1,3-6H3,(H2,28,29,30)/b16-10+,23-22-,26-11+,27-15+ |
| InChIKey | WTDAHQDRAKHSIE-LRTKKSMOSA-N |
| XLogP | 3.47 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|