About (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine
(Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine (PubChem CID 176967293) has the molecular formula C15H16Cl2FNS
and a molecular weight of 332.27 g/mol. Its IUPAC name is (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine.
Molecular Properties
| Compound Name | (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine |
| PubChem CID | 176967293 |
| Molecular Formula | C15H16Cl2FNS |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine |
| SMILES | CC/C=C(C)\C=N/C(Sc1cccc(Cl)c1Cl)=C(\C)F |
| InChI | InChI=1S/C15H16Cl2FNS/c1-4-6-10(2)9-19-15(11(3)18)20-13-8-5-7-12(16)14(13)17/h5-9H,4H2,1-3H3/b10-6-,15-11-,19-9- |
| InChIKey | VXCHNDZJBPCQHJ-XRLBOEDTSA-N |
| XLogP | 6.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine?
The IUPAC name of (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine (CID 176967293) is (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine.
What is the SMILES notation for (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine?
The canonical SMILES for (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine is CC/C=C(C)\C=N/C(Sc1cccc(Cl)c1Cl)=C(\C)F.
What is the InChIKey of (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine?
The InChIKey is VXCHNDZJBPCQHJ-XRLBOEDTSA-N. The full InChI is InChI=1S/C15H16Cl2FNS/c1-4-6-10(2)9-19-15(11(3)18)20-13-8-5-7-12(16)14(13)17/h5-9H,4H2,1-3H3/b10-6-,15-11-,19-9-.
What are the key properties of (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine?
(Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine has a molecular weight of 332.27 g/mol, XLogP of 6.67, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,Z)-N-[(Z)-1-(2,3-dichlorophenyl)sulfanyl-2-fluoroprop-1-enyl]-2-methylpent-2-en-1-imine is sourced from PubChem (CID 176967293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).