About 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole
1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole (PubChem CID 176967825) has the molecular formula C24H29ClN2O2S
and a molecular weight of 445.03 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole.
Molecular Properties
| Compound Name | 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole |
| PubChem CID | 176967825 |
| Molecular Formula | C24H29ClN2O2S |
| Molecular Weight | 445.03 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole |
| SMILES | CCCC(=O)OC(CCC)c1ccc(Cl)c(C)c1.Cc1cc(-c2ccncc2)ns1 |
| InChI | InChI=1S/C15H21ClO2.C9H8N2S/c1-4-6-14(18-15(17)7-5-2)12-8-9-13(16)11(3)10-12;1-7-6-9(11-12-7)8-2-4-10-5-3-8/h8-10,14H,4-7H2,1-3H3;2-6H,1H3 |
| InChIKey | QFJLBMZHZGZLPV-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.03 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole?
The IUPAC name of 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole (CID 176967825) is 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole.
What is the SMILES notation for 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole?
The canonical SMILES for 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole is CCCC(=O)OC(CCC)c1ccc(Cl)c(C)c1.Cc1cc(-c2ccncc2)ns1.
What is the InChIKey of 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole?
The InChIKey is QFJLBMZHZGZLPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClO2.C9H8N2S/c1-4-6-14(18-15(17)7-5-2)12-8-9-13(16)11(3)10-12;1-7-6-9(11-12-7)8-2-4-10-5-3-8/h8-10,14H,4-7H2,1-3H3;2-6H,1H3.
What are the key properties of 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole?
1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole has a molecular weight of 445.03 g/mol, XLogP of 7.35, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-3-methylphenyl)butyl butanoate;5-methyl-3-pyridin-4-yl-1,2-thiazole is sourced from PubChem (CID 176967825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).