C19H30F2O2 — CID 176967915
[(5E,6Z,8E)-8-(1,1-difluoroethyl)-5-ethylideneundeca-6,8-dien-4-yl] butanoate (PubChem CID 176967915) has the molecular formula C19H30F2O2 and a molecular weight of 328.44 g/mol. Its IUPAC name is [(5E,6Z,8E)-8-(1,1-difluoroethyl)-5-ethylideneundeca-6,8-dien-4-yl] butanoate.
| Compound Name | [(5E,6Z,8E)-8-(1,1-difluoroethyl)-5-ethylideneundeca-6,8-dien-4-yl] butanoate |
|---|---|
| PubChem CID | 176967915 |
| Molecular Formula | C19H30F2O2 |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | [(5E,6Z,8E)-8-(1,1-difluoroethyl)-5-ethylideneundeca-6,8-dien-4-yl] butanoate |
| SMILES | C/C=C(\C=C/C(=C\CC)C(C)(F)F)C(CCC)OC(=O)CCC |
| InChI | InChI=1S/C19H30F2O2/c1-6-10-16(19(5,20)21)14-13-15(9-4)17(11-7-2)23-18(22)12-8-3/h9-10,13-14,17H,6-8,11-12H2,1-5H3/b14-13-,15-9+,16-10+ |
| InChIKey | DKTDRIGYRVGCTD-SVCOELSASA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|