C46H86N2O4 — CID 176968823
[2-[(4-ethylpiperazin-1-yl)methyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate (PubChem CID 176968823) has the molecular formula C46H86N2O4 and a molecular weight of 731.20 g/mol. Its IUPAC name is [2-[(4-ethylpiperazin-1-yl)methyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [2-[(4-ethylpiperazin-1-yl)methyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 176968823 |
| Molecular Formula | C46H86N2O4 |
| Molecular Weight | 731.20 g/mol |
| Exact Mass | 730.66 |
| IUPAC Name | [2-[(4-ethylpiperazin-1-yl)methyl]-3-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCCCC)CN1CCN(CC)CC1 |
| InChI | InChI=1S/C46H86N2O4/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-45(49)51-42-44(41-48-39-37-47(6-3)38-40-48)43-52-46(50)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h19-22,44H,4-18,23-43H2,1-3H3/b21-19-,22-20- |
| InChIKey | DSZSZEAIKIGIIE-WRBBJXAJSA-N |
| XLogP | 12.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.20 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|