C29H31BrN2O7S — CID 176968978
(1R,2R,3S,3aR,8bR)-3a-(4-bromophenyl)-N-(dimethylsulfamoyl)-1-hydroxy-6,8-dimethoxy-8b-methyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide (PubChem CID 176968978) has the molecular formula C29H31BrN2O7S and a molecular weight of 631.55 g/mol. Its IUPAC name is (1R,2R,3S,3aR,8bR)-3a-(4-bromophenyl)-N-(dimethylsulfamoyl)-1-hydroxy-6,8-dimethoxy-8b-methyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide.
| Compound Name | (1R,2R,3S,3aR,8bR)-3a-(4-bromophenyl)-N-(dimethylsulfamoyl)-1-hydroxy-6,8-dimethoxy-8b-methyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 176968978 |
| Molecular Formula | C29H31BrN2O7S |
| Molecular Weight | 631.55 g/mol |
| Exact Mass | 630.10 |
| IUPAC Name | (1R,2R,3S,3aR,8bR)-3a-(4-bromophenyl)-N-(dimethylsulfamoyl)-1-hydroxy-6,8-dimethoxy-8b-methyl-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
| SMILES | COc1cc(OC)c2c(c1)O[C@@]1(c3ccc(Br)cc3)[C@H](c3ccccc3)[C@@H](C(=O)NS(=O)(=O)N(C)C)[C@@H](O)[C@@]21C |
| InChI | InChI=1S/C29H31BrN2O7S/c1-28-25-21(38-5)15-20(37-4)16-22(25)39-29(28,18-11-13-19(30)14-12-18)24(17-9-7-6-8-10-17)23(26(28)33)27(34)31-40(35,36)32(2)3/h6-16,23-24,26,33H,1-5H3,(H,31,34)/t23-,24-,26-,28-,29+/m1/s1 |
| InChIKey | AWWZINJFLWCDHC-KFWOPUAOSA-N |
| XLogP | 3.71 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |