C29H41FN2O — CID 176969168
6-(3-fluoro-4,5-dimethylphenyl)-1-[3-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]nonan-4-one (PubChem CID 176969168) has the molecular formula C29H41FN2O and a molecular weight of 452.66 g/mol. Its IUPAC name is 6-(3-fluoro-4,5-dimethylphenyl)-1-[3-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]nonan-4-one.
| Compound Name | 6-(3-fluoro-4,5-dimethylphenyl)-1-[3-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]nonan-4-one |
|---|---|
| PubChem CID | 176969168 |
| Molecular Formula | C29H41FN2O |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | 6-(3-fluoro-4,5-dimethylphenyl)-1-[3-[(2Z,4E,6E)-nona-2,4,6-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]nonan-4-one |
| SMILES | C/C=C\C(=C/C=C/CC)C1=NNC(CCCC(=O)CC(CCC)c2cc(C)c(C)c(F)c2)C1 |
| InChI | InChI=1S/C29H41FN2O/c1-6-9-10-14-23(12-7-2)29-20-26(31-32-29)15-11-16-27(33)18-24(13-8-3)25-17-21(4)22(5)28(30)19-25/h7,9-10,12,14,17,19,24,26,31H,6,8,11,13,15-16,18,20H2,1-5H3/b10-9+,12-7-,23-14+ |
| InChIKey | DFYRCLPCUQRDOT-IDNJVAFUSA-N |
| XLogP | 7.64 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|