C25H32F2N2O — CID 176969186
6-(3,4-difluorophenyl)-1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]nonan-4-one (PubChem CID 176969186) has the molecular formula C25H32F2N2O and a molecular weight of 414.54 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]nonan-4-one.
| Compound Name | 6-(3,4-difluorophenyl)-1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]nonan-4-one |
|---|---|
| PubChem CID | 176969186 |
| Molecular Formula | C25H32F2N2O |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 6-(3,4-difluorophenyl)-1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]nonan-4-one |
| SMILES | C=C/C=C(\C=C/C)C1=NNC(CCCC(=O)CC(CCC)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C25H32F2N2O/c1-4-8-18(9-5-2)25-17-21(28-29-25)11-7-12-22(30)15-19(10-6-3)20-13-14-23(26)24(27)16-20/h4-5,8-9,13-14,16,19,21,28H,1,6-7,10-12,15,17H2,2-3H3/b9-5-,18-8+ |
| InChIKey | PVTROLFDFLQYDQ-MZHOJPJSSA-N |
| XLogP | 6.38 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|