C16H23FO2 — CID 176969201
6-(4-fluoro-3-methylphenyl)-6-hydroxynonan-4-one (PubChem CID 176969201) has the molecular formula C16H23FO2 and a molecular weight of 266.36 g/mol. Its IUPAC name is 6-(4-fluoro-3-methylphenyl)-6-hydroxynonan-4-one.
| Compound Name | 6-(4-fluoro-3-methylphenyl)-6-hydroxynonan-4-one |
|---|---|
| PubChem CID | 176969201 |
| Molecular Formula | C16H23FO2 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 6-(4-fluoro-3-methylphenyl)-6-hydroxynonan-4-one |
| SMILES | CCCC(=O)CC(O)(CCC)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C16H23FO2/c1-4-6-14(18)11-16(19,9-5-2)13-7-8-15(17)12(3)10-13/h7-8,10,19H,4-6,9,11H2,1-3H3 |
| InChIKey | JFZUKMUPWGTGEQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |