C26H33F3N2O — CID 176969212
1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]-6-[3-(trifluoromethyl)phenyl]nonan-4-one (PubChem CID 176969212) has the molecular formula C26H33F3N2O and a molecular weight of 446.56 g/mol. Its IUPAC name is 1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]-6-[3-(trifluoromethyl)phenyl]nonan-4-one.
| Compound Name | 1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]-6-[3-(trifluoromethyl)phenyl]nonan-4-one |
|---|---|
| PubChem CID | 176969212 |
| Molecular Formula | C26H33F3N2O |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]-6-[3-(trifluoromethyl)phenyl]nonan-4-one |
| SMILES | C=C/C=C(\C=C/C)C1=NNC(CCCC(=O)CC(CCC)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C26H33F3N2O/c1-4-9-19(10-5-2)25-18-23(30-31-25)14-8-15-24(32)17-20(11-6-3)21-12-7-13-22(16-21)26(27,28)29/h4-5,7,9-10,12-13,16,20,23,30H,1,6,8,11,14-15,17-18H2,2-3H3/b10-5-,19-9+ |
| InChIKey | FJQJDRJVQLIZKW-ISHQYZRCSA-N |
| XLogP | 7.12 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|