About 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole
3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole (PubChem CID 176969255) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole.
Molecular Properties
| Compound Name | 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole |
| PubChem CID | 176969255 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole |
| SMILES | CC=C/C=C(\CC)c1cc(C)[nH]n1 |
| InChI | InChI=1S/C11H16N2/c1-4-6-7-10(5-2)11-8-9(3)12-13-11/h4,6-8H,5H2,1-3H3,(H,12,13)/b6-4?,10-7+ |
| InChIKey | DJSAIDLVAAFPKM-DLPYHVJQSA-N |
| XLogP | 3.09 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole?
The IUPAC name of 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole (CID 176969255) is 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole.
What is the SMILES notation for 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole?
The canonical SMILES for 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole is CC=C/C=C(\CC)c1cc(C)[nH]n1.
What is the InChIKey of 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole?
The InChIKey is DJSAIDLVAAFPKM-DLPYHVJQSA-N. The full InChI is InChI=1S/C11H16N2/c1-4-6-7-10(5-2)11-8-9(3)12-13-11/h4,6-8H,5H2,1-3H3,(H,12,13)/b6-4?,10-7+.
What are the key properties of 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole?
3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole has a molecular weight of 176.26 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3E)-hepta-3,5-dien-3-yl]-5-methyl-1H-pyrazole is sourced from PubChem (CID 176969255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).