C26H35FN2O — CID 176969311
6-(4-fluorophenyl)-1-[3-[(2Z,4E)-octa-2,4,6-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]nonan-4-one (PubChem CID 176969311) has the molecular formula C26H35FN2O and a molecular weight of 410.58 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1-[3-[(2Z,4E)-octa-2,4,6-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]nonan-4-one.
| Compound Name | 6-(4-fluorophenyl)-1-[3-[(2Z,4E)-octa-2,4,6-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]nonan-4-one |
|---|---|
| PubChem CID | 176969311 |
| Molecular Formula | C26H35FN2O |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 6-(4-fluorophenyl)-1-[3-[(2Z,4E)-octa-2,4,6-trien-4-yl]-4,5-dihydro-1H-pyrazol-5-yl]nonan-4-one |
| SMILES | CC=C/C=C(\C=C/C)C1=NNC(CCCC(=O)CC(CCC)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C26H35FN2O/c1-4-7-11-21(9-5-2)26-19-24(28-29-26)12-8-13-25(30)18-22(10-6-3)20-14-16-23(27)17-15-20/h4-5,7,9,11,14-17,22,24,28H,6,8,10,12-13,18-19H2,1-3H3/b7-4?,9-5-,21-11+ |
| InChIKey | MLFZAIOQMKDNIA-DRJPSEGLSA-N |
| XLogP | 6.64 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|