About 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene
3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene (PubChem CID 176969550) has the molecular formula C26H46O2
and a molecular weight of 390.65 g/mol. Its IUPAC name is 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene.
Molecular Properties
| Compound Name | 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene |
| PubChem CID | 176969550 |
| Molecular Formula | C26H46O2 |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene |
| SMILES | C=C=C(CCCCCCCC)OCC(CC)CC(=C=C)OC[C@@H](C)CCCC |
| InChI | InChI=1S/C26H46O2/c1-7-12-14-15-16-17-19-25(10-4)28-22-24(9-3)20-26(11-5)27-21-23(6)18-13-8-2/h23-24H,4-5,7-9,12-22H2,1-3,6H3/t23-,24?/m0/s1 |
| InChIKey | KVUBEPCEAFCSKW-UXMRNZNESA-N |
| XLogP | 8.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene?
The IUPAC name of 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene (CID 176969550) is 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene.
What is the SMILES notation for 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene?
The canonical SMILES for 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene is C=C=C(CCCCCCCC)OCC(CC)CC(=C=C)OC[C@@H](C)CCCC.
What is the InChIKey of 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene?
The InChIKey is KVUBEPCEAFCSKW-UXMRNZNESA-N. The full InChI is InChI=1S/C26H46O2/c1-7-12-14-15-16-17-19-25(10-4)28-22-24(9-3)20-26(11-5)27-21-23(6)18-13-8-2/h23-24H,4-5,7-9,12-22H2,1-3,6H3/t23-,24?/m0/s1.
What are the key properties of 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene?
3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene has a molecular weight of 390.65 g/mol, XLogP of 8.35, 19 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-ethyl-4-[(2S)-2-methylhexoxy]hexa-4,5-dienoxy]undeca-1,2-diene is sourced from PubChem (CID 176969550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).