C17H25NO — CID 176970068
5-(3-methylbuta-1,3-dien-2-yl)-4-[2-(oxolan-3-yl)prop-2-enyl]-1,2,3,6-tetrahydropyridine (PubChem CID 176970068) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 5-(3-methylbuta-1,3-dien-2-yl)-4-[2-(oxolan-3-yl)prop-2-enyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-(3-methylbuta-1,3-dien-2-yl)-4-[2-(oxolan-3-yl)prop-2-enyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 176970068 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 5-(3-methylbuta-1,3-dien-2-yl)-4-[2-(oxolan-3-yl)prop-2-enyl]-1,2,3,6-tetrahydropyridine |
| SMILES | C=C(C)C(=C)C1=C(CC(=C)C2CCOC2)CCNC1 |
| InChI | InChI=1S/C17H25NO/c1-12(2)14(4)17-10-18-7-5-15(17)9-13(3)16-6-8-19-11-16/h16,18H,1,3-11H2,2H3 |
| InChIKey | PZJFZLBOSAORTL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|