About 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate
2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate (PubChem CID 176970262) has the molecular formula C13H23NO2S2
and a molecular weight of 289.47 g/mol. Its IUPAC name is 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate.
Molecular Properties
| Compound Name | 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate |
| PubChem CID | 176970262 |
| Molecular Formula | C13H23NO2S2 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate |
| SMILES | CCC.O.O.Sc1csc(C#CC2CCCC2)n1 |
| InChI | InChI=1S/C10H11NS2.C3H8.2H2O/c12-9-7-13-10(11-9)6-5-8-3-1-2-4-8;1-3-2;;/h7-8,12H,1-4H2;3H2,1-2H3;2*1H2 |
| InChIKey | RLRJGTMQRQKEQN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate?
The IUPAC name of 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate (CID 176970262) is 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate.
What is the SMILES notation for 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate?
The canonical SMILES for 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate is CCC.O.O.Sc1csc(C#CC2CCCC2)n1.
What is the InChIKey of 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate?
The InChIKey is RLRJGTMQRQKEQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NS2.C3H8.2H2O/c12-9-7-13-10(11-9)6-5-8-3-1-2-4-8;1-3-2;;/h7-8,12H,1-4H2;3H2,1-2H3;2*1H2.
What are the key properties of 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate?
2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate has a molecular weight of 289.47 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclopentylethynyl)-1,3-thiazole-4-thiol;propane;dihydrate is sourced from PubChem (CID 176970262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).