C19H35F3N2O5 — CID 176970719
tert-butyl 4-[5-[methoxy(methyl)amino]-5-oxopentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate;1,1,1-trifluoroethane (PubChem CID 176970719) has the molecular formula C19H35F3N2O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is tert-butyl 4-[5-[methoxy(methyl)amino]-5-oxopentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate;1,1,1-trifluoroethane.
| Compound Name | tert-butyl 4-[5-[methoxy(methyl)amino]-5-oxopentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 176970719 |
| Molecular Formula | C19H35F3N2O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | tert-butyl 4-[5-[methoxy(methyl)amino]-5-oxopentyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.CON(C)C(=O)CCCCC1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H32N2O5.C2H3F3/c1-16(2,3)24-15(21)19-13(12-23-17(19,4)5)10-8-9-11-14(20)18(6)22-7;1-2(3,4)5/h13H,8-12H2,1-7H3;1H3 |
| InChIKey | DQSAWVBRBDQKNT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|