About cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide
cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide (PubChem CID 176970861) has the molecular formula C19H37NO3
and a molecular weight of 327.51 g/mol. Its IUPAC name is cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide.
Molecular Properties
| Compound Name | cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide |
| PubChem CID | 176970861 |
| Molecular Formula | C19H37NO3 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.28 |
| IUPAC Name | cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide |
| SMILES | C1CCC1.CCC(CC/C=C/C(=O)N(C)OC)COC(C)(C)C |
| InChI | InChI=1S/C15H29NO3.C4H8/c1-7-13(12-19-15(2,3)4)10-8-9-11-14(17)16(5)18-6;1-2-4-3-1/h9,11,13H,7-8,10,12H2,1-6H3;1-4H2/b11-9+; |
| InChIKey | INGYARCDTYUDRD-LBEJWNQZSA-N |
| XLogP | 4.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide?
The IUPAC name of cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide (CID 176970861) is cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide.
What is the SMILES notation for cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide?
The canonical SMILES for cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide is C1CCC1.CCC(CC/C=C/C(=O)N(C)OC)COC(C)(C)C.
What is the InChIKey of cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide?
The InChIKey is INGYARCDTYUDRD-LBEJWNQZSA-N. The full InChI is InChI=1S/C15H29NO3.C4H8/c1-7-13(12-19-15(2,3)4)10-8-9-11-14(17)16(5)18-6;1-2-4-3-1/h9,11,13H,7-8,10,12H2,1-6H3;1-4H2/b11-9+;.
What are the key properties of cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide?
cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide has a molecular weight of 327.51 g/mol, XLogP of 4.74, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutane;(E)-N-methoxy-N-methyl-6-[(2-methylpropan-2-yl)oxymethyl]oct-2-enamide is sourced from PubChem (CID 176970861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).