About N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide
N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide (PubChem CID 176971098) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide.
Molecular Properties
| Compound Name | N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide |
| PubChem CID | 176971098 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide |
| SMILES | C=CN/C=C(/C(C)CC)N(C)/C(C)=N/C |
| InChI | InChI=1S/C12H23N3/c1-7-10(3)12(9-14-8-2)15(6)11(4)13-5/h8-10,14H,2,7H2,1,3-6H3/b12-9-,13-11+ |
| InChIKey | DPGSKIGZAYSUSR-GKRPZIRTSA-N |
| XLogP | 2.59 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide?
The IUPAC name of N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide (CID 176971098) is N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide.
What is the SMILES notation for N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide?
The canonical SMILES for N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide is C=CN/C=C(/C(C)CC)N(C)/C(C)=N/C.
What is the InChIKey of N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide?
The InChIKey is DPGSKIGZAYSUSR-GKRPZIRTSA-N. The full InChI is InChI=1S/C12H23N3/c1-7-10(3)12(9-14-8-2)15(6)11(4)13-5/h8-10,14H,2,7H2,1,3-6H3/b12-9-,13-11+.
What are the key properties of N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide?
N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide has a molecular weight of 209.34 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-(ethenylamino)-3-methylpent-1-en-2-yl]-N,N'-dimethylethanimidamide is sourced from PubChem (CID 176971098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).