About tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate
tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate (PubChem CID 176971268) has the molecular formula C17H20ClN3O2
and a molecular weight of 333.82 g/mol. Its IUPAC name is tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate |
| PubChem CID | 176971268 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate |
| SMILES | Cc1cccc(C)c1-c1cc(Cl)nc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-10-7-6-8-11(2)14(10)12-9-13(18)20-15(19-12)21-16(22)23-17(3,4)5/h6-9H,1-5H3,(H,19,20,21,22) |
| InChIKey | IAVSCWNNCUXJMW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate?
The IUPAC name of tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate (CID 176971268) is tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate is Cc1cccc(C)c1-c1cc(Cl)nc(NC(=O)OC(C)(C)C)n1.
What is the InChIKey of tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate?
The InChIKey is IAVSCWNNCUXJMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3O2/c1-10-7-6-8-11(2)14(10)12-9-13(18)20-15(19-12)21-16(22)23-17(3,4)5/h6-9H,1-5H3,(H,19,20,21,22).
What are the key properties of tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate?
tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate has a molecular weight of 333.82 g/mol, XLogP of 4.76, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]carbamate is sourced from PubChem (CID 176971268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).