C19H14F3N5O4 — CID 176971810
2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[6-(trifluoromethyl)pyridazin-3-yl]-3H-isoindole-5-carboxamide (PubChem CID 176971810) has the molecular formula C19H14F3N5O4 and a molecular weight of 433.35 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[6-(trifluoromethyl)pyridazin-3-yl]-3H-isoindole-5-carboxamide.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[6-(trifluoromethyl)pyridazin-3-yl]-3H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 176971810 |
| Molecular Formula | C19H14F3N5O4 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-1-oxo-N-[6-(trifluoromethyl)pyridazin-3-yl]-3H-isoindole-5-carboxamide |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)Nc4ccc(C(F)(F)F)nn4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H14F3N5O4/c20-19(21,22)13-4-5-14(26-25-13)23-16(29)9-1-2-11-10(7-9)8-27(18(11)31)12-3-6-15(28)24-17(12)30/h1-2,4-5,7,12H,3,6,8H2,(H,23,26,29)(H,24,28,30) |
| InChIKey | GBABQVPLZRQRCD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|