About ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline
ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline (PubChem CID 176972178) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline.
Molecular Properties
| Compound Name | ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline |
| PubChem CID | 176972178 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline |
| SMILES | CC.Cc1cncc2c1=CC1CC1C=2 |
| InChI | InChI=1S/C11H11N.C2H6/c1-7-5-12-6-10-3-8-2-9(8)4-11(7)10;1-2/h3-6,8-9H,2H2,1H3;1-2H3 |
| InChIKey | XBFGZHFLHNIUCQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline?
The IUPAC name of ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline (CID 176972178) is ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline.
What is the SMILES notation for ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline?
The canonical SMILES for ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline is CC.Cc1cncc2c1=CC1CC1C=2.
What is the InChIKey of ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline?
The InChIKey is XBFGZHFLHNIUCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N.C2H6/c1-7-5-12-6-10-3-8-2-9(8)4-11(7)10;1-2/h3-6,8-9H,2H2,1H3;1-2H3.
What are the key properties of ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline?
ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline has a molecular weight of 187.29 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-6,6a-dihydro-5aH-cyclopropa[g]isoquinoline is sourced from PubChem (CID 176972178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).