C14H16IN3O — CID 176972823
3-[1-(3-iodophenyl)-3-methoxycyclobutyl]-4-methyl-1,2,4-triazole (PubChem CID 176972823) has the molecular formula C14H16IN3O and a molecular weight of 369.21 g/mol. Its IUPAC name is 3-[1-(3-iodophenyl)-3-methoxycyclobutyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-[1-(3-iodophenyl)-3-methoxycyclobutyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 176972823 |
| Molecular Formula | C14H16IN3O |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 3-[1-(3-iodophenyl)-3-methoxycyclobutyl]-4-methyl-1,2,4-triazole |
| SMILES | COC1CC(c2cccc(I)c2)(c2nncn2C)C1 |
| InChI | InChI=1S/C14H16IN3O/c1-18-9-16-17-13(18)14(7-12(8-14)19-2)10-4-3-5-11(15)6-10/h3-6,9,12H,7-8H2,1-2H3 |
| InChIKey | DJVOSEURIQJCME-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|