C21H27BrN4O2 — CID 176973174
tert-butyl 4-[(6-bromo-8-prop-1-en-2-ylquinazolin-2-yl)amino]piperidine-1-carboxylate (PubChem CID 176973174) has the molecular formula C21H27BrN4O2 and a molecular weight of 447.38 g/mol. Its IUPAC name is tert-butyl 4-[(6-bromo-8-prop-1-en-2-ylquinazolin-2-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(6-bromo-8-prop-1-en-2-ylquinazolin-2-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 176973174 |
| Molecular Formula | C21H27BrN4O2 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | tert-butyl 4-[(6-bromo-8-prop-1-en-2-ylquinazolin-2-yl)amino]piperidine-1-carboxylate |
| SMILES | C=C(C)c1cc(Br)cc2cnc(NC3CCN(C(=O)OC(C)(C)C)CC3)nc12 |
| InChI | InChI=1S/C21H27BrN4O2/c1-13(2)17-11-15(22)10-14-12-23-19(25-18(14)17)24-16-6-8-26(9-7-16)20(27)28-21(3,4)5/h10-12,16H,1,6-9H2,2-5H3,(H,23,24,25) |
| InChIKey | KOPAVSZJUOMCNI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |