About 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane
6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane (PubChem CID 176973341) has the molecular formula C14H23ClO
and a molecular weight of 242.79 g/mol. Its IUPAC name is 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane.
Molecular Properties
| Compound Name | 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane |
| PubChem CID | 176973341 |
| Molecular Formula | C14H23ClO |
| Molecular Weight | 242.79 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane |
| SMILES | CC.CC.Cc1cc(Cl)cc2c1CCC2O |
| InChI | InChI=1S/C10H11ClO.2C2H6/c1-6-4-7(11)5-9-8(6)2-3-10(9)12;2*1-2/h4-5,10,12H,2-3H2,1H3;2*1-2H3 |
| InChIKey | XGCBNMRQKKDEDI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.79 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane?
The IUPAC name of 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane (CID 176973341) is 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane.
What is the SMILES notation for 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane?
The canonical SMILES for 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane is CC.CC.Cc1cc(Cl)cc2c1CCC2O.
What is the InChIKey of 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane?
The InChIKey is XGCBNMRQKKDEDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO.2C2H6/c1-6-4-7(11)5-9-8(6)2-3-10(9)12;2*1-2/h4-5,10,12H,2-3H2,1H3;2*1-2H3.
What are the key properties of 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane?
6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane has a molecular weight of 242.79 g/mol, XLogP of 4.68, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-methyl-2,3-dihydro-1H-inden-1-ol;ethane is sourced from PubChem (CID 176973341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).