About N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide
N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide (PubChem CID 176973944) has the molecular formula C9H11ClN4O
and a molecular weight of 226.67 g/mol. Its IUPAC name is N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide.
Molecular Properties
| Compound Name | N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide |
| PubChem CID | 176973944 |
| Molecular Formula | C9H11ClN4O |
| Molecular Weight | 226.67 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide |
| SMILES | CC(=O)c1cc(Cl)ccc1N(N)/C=N\N |
| InChI | InChI=1S/C9H11ClN4O/c1-6(15)8-4-7(10)2-3-9(8)14(12)5-13-11/h2-5H,11-12H2,1H3/b13-5- |
| InChIKey | PMESEEPKPOBRMC-ACAGNQJTSA-N |
| XLogP | 1.12 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.67 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide?
The IUPAC name of N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide (CID 176973944) is N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide.
What is the SMILES notation for N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide?
The canonical SMILES for N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide is CC(=O)c1cc(Cl)ccc1N(N)/C=N\N.
What is the InChIKey of N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide?
The InChIKey is PMESEEPKPOBRMC-ACAGNQJTSA-N. The full InChI is InChI=1S/C9H11ClN4O/c1-6(15)8-4-7(10)2-3-9(8)14(12)5-13-11/h2-5H,11-12H2,1H3/b13-5-.
What are the key properties of N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide?
N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide has a molecular weight of 226.67 g/mol, XLogP of 1.12, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-acetyl-4-chlorophenyl)-N,N'-diaminomethanimidamide is sourced from PubChem (CID 176973944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).