C27H31N5O2S — CID 176974031
3-[[cyclopentyl(phenyl)methyl]amino]-N-(5,6-dihydro-4H-thieno[2,3-c]pyrrol-2-ylmethyl)-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-6-carboxamide (PubChem CID 176974031) has the molecular formula C27H31N5O2S and a molecular weight of 489.65 g/mol. Its IUPAC name is 3-[[cyclopentyl(phenyl)methyl]amino]-N-(5,6-dihydro-4H-thieno[2,3-c]pyrrol-2-ylmethyl)-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-6-carboxamide.
| Compound Name | 3-[[cyclopentyl(phenyl)methyl]amino]-N-(5,6-dihydro-4H-thieno[2,3-c]pyrrol-2-ylmethyl)-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 176974031 |
| Molecular Formula | C27H31N5O2S |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 3-[[cyclopentyl(phenyl)methyl]amino]-N-(5,6-dihydro-4H-thieno[2,3-c]pyrrol-2-ylmethyl)-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-6-carboxamide |
| SMILES | O=C(NCc1cc2c(s1)CNC2)C1CCc2cnc(NC(c3ccccc3)C3CCCC3)c(=O)n21 |
| InChI | InChI=1S/C27H31N5O2S/c33-26(30-15-21-12-19-13-28-16-23(19)35-21)22-11-10-20-14-29-25(27(34)32(20)22)31-24(18-8-4-5-9-18)17-6-2-1-3-7-17/h1-3,6-7,12,14,18,22,24,28H,4-5,8-11,13,15-16H2,(H,29,31)(H,30,33) |
| InChIKey | SZOWHYHBZZCZKY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |