C35H43N5O4S — CID 176974067
tert-butyl 2-[[[3-[[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]methylamino]-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-6-carbonyl]amino]methyl]-4,6-dihydrothieno[2,3-c]pyrrole-5-carboxylate;ethane (PubChem CID 176974067) has the molecular formula C35H43N5O4S and a molecular weight of 629.83 g/mol. Its IUPAC name is tert-butyl 2-[[[3-[[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]methylamino]-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-6-carbonyl]amino]methyl]-4,6-dihydrothieno[2,3-c]pyrrole-5-carboxylate;ethane.
| Compound Name | tert-butyl 2-[[[3-[[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]methylamino]-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-6-carbonyl]amino]methyl]-4,6-dihydrothieno[2,3-c]pyrrole-5-carboxylate;ethane |
|---|---|
| PubChem CID | 176974067 |
| Molecular Formula | C35H43N5O4S |
| Molecular Weight | 629.83 g/mol |
| Exact Mass | 629.30 |
| IUPAC Name | tert-butyl 2-[[[3-[[3-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]methylamino]-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrazine-6-carbonyl]amino]methyl]-4,6-dihydrothieno[2,3-c]pyrrole-5-carboxylate;ethane |
| SMILES | C=C/C=C(\C=C)c1cccc(CNc2ncc3n(c2=O)C(C(=O)NCc2cc4c(s2)CN(C(=O)OC(C)(C)C)C4)CC3)c1.CC |
| InChI | InChI=1S/C33H37N5O4S.C2H6/c1-6-9-22(7-2)23-11-8-10-21(14-23)16-34-29-31(40)38-25(17-35-29)12-13-27(38)30(39)36-18-26-15-24-19-37(20-28(24)43-26)32(41)42-33(3,4)5;1-2/h6-11,14-15,17,27H,1-2,12-13,16,18-20H2,3-5H3,(H,34,35)(H,36,39);1-2H3/b22-9+; |
| InChIKey | LBXJYURLFSBMFE-PXSFLOMMSA-N |
| XLogP | 6.75 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.83 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|