About CID 176974366
CID 176974366 (PubChem CID 176974366) has the molecular formula C17H18ClF4N5O2Si+
and a molecular weight of 463.90 g/mol.
Molecular Properties
| Compound Name | CID 176974366 |
| PubChem CID | 176974366 |
| Molecular Formula | C17H18ClF4N5O2Si+ |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | — |
| SMILES | O=c1[nH]c(Cl)c(F)c2nc(OC[C@@]34CCC[N+]3([Si])C[C@H](F)C4)nc(NCC(F)F)c12 |
| InChI | InChI=1S/C17H18ClF4N5O2Si/c18-13-11(22)12-10(15(28)25-13)14(23-5-9(20)21)26-16(24-12)29-7-17-2-1-3-27(17,30)6-8(19)4-17/h8-9H,1-7H2,(H,25,28)(H,23,24,26)/q+1/t8-,17+,27?/m1/s1 |
| InChIKey | POZOAJIWCGRCIK-WZJUPVSMSA-N |
| XLogP | 2.34 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 176974366 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176974366?
The IUPAC name of CID 176974366 (CID 176974366) is not available.
What is the SMILES notation for CID 176974366?
The canonical SMILES for CID 176974366 is O=c1[nH]c(Cl)c(F)c2nc(OC[C@@]34CCC[N+]3([Si])C[C@H](F)C4)nc(NCC(F)F)c12.
What is the InChIKey of CID 176974366?
The InChIKey is POZOAJIWCGRCIK-WZJUPVSMSA-N. The full InChI is InChI=1S/C17H18ClF4N5O2Si/c18-13-11(22)12-10(15(28)25-13)14(23-5-9(20)21)26-16(24-12)29-7-17-2-1-3-27(17,30)6-8(19)4-17/h8-9H,1-7H2,(H,25,28)(H,23,24,26)/q+1/t8-,17+,27?/m1/s1.
What are the key properties of CID 176974366?
CID 176974366 has a molecular weight of 463.90 g/mol, XLogP of 2.34, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176974366 is sourced from PubChem (CID 176974366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).