C26H22F4IN8OPS — CID 176974501
3-[1-[6-fluoro-7-[1-iodophosphanyl-6-methyl-5-(trifluoromethyl)indazol-4-yl]-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl]ethyl]pyridin-2-amine (PubChem CID 176974501) has the molecular formula C26H22F4IN8OPS and a molecular weight of 728.45 g/mol. Its IUPAC name is 3-[1-[6-fluoro-7-[1-iodophosphanyl-6-methyl-5-(trifluoromethyl)indazol-4-yl]-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl]ethyl]pyridin-2-amine.
| Compound Name | 3-[1-[6-fluoro-7-[1-iodophosphanyl-6-methyl-5-(trifluoromethyl)indazol-4-yl]-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl]ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 176974501 |
| Molecular Formula | C26H22F4IN8OPS |
| Molecular Weight | 728.45 g/mol |
| Exact Mass | 728.04 |
| IUPAC Name | 3-[1-[6-fluoro-7-[1-iodophosphanyl-6-methyl-5-(trifluoromethyl)indazol-4-yl]-3-methylsulfanyl-10-oxa-2,4,8,13-tetrazatricyclo[7.4.1.05,14]tetradeca-1,3,5(14),6,8-pentaen-13-yl]ethyl]pyridin-2-amine |
| SMILES | CSc1nc2c3c(nc(-c4c(C(F)(F)F)c(C)cc5c4cnn5PI)c(F)c3n1)OCCN2C(C)c1cccnc1N |
| InChI | InChI=1S/C26H22F4IN8OPS/c1-11-9-15-14(10-34-39(15)41-31)16(18(11)26(28,29)30)20-19(27)21-17-23(37-25(36-21)42-3)38(7-8-40-24(17)35-20)12(2)13-5-4-6-33-22(13)32/h4-6,9-10,12,41H,7-8H2,1-3H3,(H2,32,33) |
| InChIKey | GVWPMUSAWFPXAJ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.45 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|