C19H28N2O4 — CID 176975507
acetylene;tert-butyl 2-(4-hydroxy-2-oxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-1-yl)acetate;ethane (PubChem CID 176975507) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is acetylene;tert-butyl 2-(4-hydroxy-2-oxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-1-yl)acetate;ethane.
| Compound Name | acetylene;tert-butyl 2-(4-hydroxy-2-oxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-1-yl)acetate;ethane |
|---|---|
| PubChem CID | 176975507 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | acetylene;tert-butyl 2-(4-hydroxy-2-oxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-1-yl)acetate;ethane |
| SMILES | C#C.CC.CC(C)(C)OC(=O)CN1C(=O)CC(O)Cc2cnccc21 |
| InChI | InChI=1S/C15H20N2O4.C2H6.C2H2/c1-15(2,3)21-14(20)9-17-12-4-5-16-8-10(12)6-11(18)7-13(17)19;2*1-2/h4-5,8,11,18H,6-7,9H2,1-3H3;1-2H3;1-2H |
| InChIKey | QJJQAFKTZFUDEJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|