C15H12N4O — CID 176978343
11-pyridin-3-yl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one (PubChem CID 176978343) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is 11-pyridin-3-yl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one.
| Compound Name | 11-pyridin-3-yl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
|---|---|
| PubChem CID | 176978343 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 11-pyridin-3-yl-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
| SMILES | O=c1[nH]nc2c3c(cccc13)NC(c1cccnc1)C2 |
| InChI | InChI=1S/C15H12N4O/c20-15-10-4-1-5-11-14(10)13(18-19-15)7-12(17-11)9-3-2-6-16-8-9/h1-6,8,12,17H,7H2,(H,19,20) |
| InChIKey | NZOWJDVAXQMVNH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |