C23H24FN7O2 — CID 176978457
(11S,12R)-7-fluoro-11-[4-[3-(methylamino)propoxy]phenyl]-12-(2-methyl-1,2,4-triazol-3-yl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one (PubChem CID 176978457) has the molecular formula C23H24FN7O2 and a molecular weight of 449.49 g/mol. Its IUPAC name is (11S,12R)-7-fluoro-11-[4-[3-(methylamino)propoxy]phenyl]-12-(2-methyl-1,2,4-triazol-3-yl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one.
| Compound Name | (11S,12R)-7-fluoro-11-[4-[3-(methylamino)propoxy]phenyl]-12-(2-methyl-1,2,4-triazol-3-yl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
|---|---|
| PubChem CID | 176978457 |
| Molecular Formula | C23H24FN7O2 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (11S,12R)-7-fluoro-11-[4-[3-(methylamino)propoxy]phenyl]-12-(2-methyl-1,2,4-triazol-3-yl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
| SMILES | CNCCCOc1ccc([C@H]2Nc3cc(F)cc4c(=O)[nH]nc(c34)[C@@H]2c2ncnn2C)cc1 |
| InChI | InChI=1S/C23H24FN7O2/c1-25-8-3-9-33-15-6-4-13(5-7-15)20-19(22-26-12-27-31(22)2)21-18-16(23(32)30-29-21)10-14(24)11-17(18)28-20/h4-7,10-12,19-20,25,28H,3,8-9H2,1-2H3,(H,30,32)/t19-,20-/m1/s1 |
| InChIKey | COSFERBZWDOTCB-WOJBJXKFSA-N |
| XLogP | 2.48 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|