C14H19NO2 — CID 176978983
(6E)-3,4-dimethoxy-N-methyl-6-(3-methylbut-3-en-2-ylidene)cyclohexa-2,4-dien-1-imine (PubChem CID 176978983) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (6E)-3,4-dimethoxy-N-methyl-6-(3-methylbut-3-en-2-ylidene)cyclohexa-2,4-dien-1-imine.
| Compound Name | (6E)-3,4-dimethoxy-N-methyl-6-(3-methylbut-3-en-2-ylidene)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 176978983 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (6E)-3,4-dimethoxy-N-methyl-6-(3-methylbut-3-en-2-ylidene)cyclohexa-2,4-dien-1-imine |
| SMILES | C=C(C)/C(C)=C1\C=C(OC)C(OC)=C\C1=N/C |
| InChI | InChI=1S/C14H19NO2/c1-9(2)10(3)11-7-13(16-5)14(17-6)8-12(11)15-4/h7-8H,1H2,2-6H3/b11-10+,15-12+ |
| InChIKey | OOWQQQGXRQSRHU-GCHFJXRNSA-N |
| XLogP | 3.02 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|