About 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate
2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate (PubChem CID 176979521) has the molecular formula C18H26NO7P
and a molecular weight of 399.38 g/mol. Its IUPAC name is 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate.
Molecular Properties
| Compound Name | 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate |
| PubChem CID | 176979521 |
| Molecular Formula | C18H26NO7P |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate |
| SMILES | C=C(C)COC(=O)CC(C)(C)c1c(CC(N)=O)cc(C)cc1OP(=O)(O)O |
| InChI | InChI=1S/C18H26NO7P/c1-11(2)10-25-16(21)9-18(4,5)17-13(8-15(19)20)6-12(3)7-14(17)26-27(22,23)24/h6-7H,1,8-10H2,2-5H3,(H2,19,20)(H2,22,23,24) |
| InChIKey | OABBNJXETSOHAC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate?
The IUPAC name of 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate (CID 176979521) is 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate.
What is the SMILES notation for 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate?
The canonical SMILES for 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate is C=C(C)COC(=O)CC(C)(C)c1c(CC(N)=O)cc(C)cc1OP(=O)(O)O.
What is the InChIKey of 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate?
The InChIKey is OABBNJXETSOHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26NO7P/c1-11(2)10-25-16(21)9-18(4,5)17-13(8-15(19)20)6-12(3)7-14(17)26-27(22,23)24/h6-7H,1,8-10H2,2-5H3,(H2,19,20)(H2,22,23,24).
What are the key properties of 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate?
2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate has a molecular weight of 399.38 g/mol, XLogP of 2.28, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enyl 3-[2-(2-amino-2-oxoethyl)-4-methyl-6-phosphonooxyphenyl]-3-methylbutanoate is sourced from PubChem (CID 176979521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).