C11H9N7O2S — CID 176980561
6-phenoxy-4-(2H-tetrazol-5-ylmethylsulfanyl)-1H-1,3,5-triazin-2-one (PubChem CID 176980561) has the molecular formula C11H9N7O2S and a molecular weight of 303.31 g/mol. Its IUPAC name is 6-phenoxy-4-(2H-tetrazol-5-ylmethylsulfanyl)-1H-1,3,5-triazin-2-one.
| Compound Name | 6-phenoxy-4-(2H-tetrazol-5-ylmethylsulfanyl)-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 176980561 |
| Molecular Formula | C11H9N7O2S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 6-phenoxy-4-(2H-tetrazol-5-ylmethylsulfanyl)-1H-1,3,5-triazin-2-one |
| SMILES | O=c1nc(SCc2nn[nH]n2)nc(Oc2ccccc2)[nH]1 |
| InChI | InChI=1S/C11H9N7O2S/c19-9-12-10(20-7-4-2-1-3-5-7)14-11(13-9)21-6-8-15-17-18-16-8/h1-5H,6H2,(H,12,13,14,19)(H,15,16,17,18) |
| InChIKey | AAKZDBMRBGALGO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |