C11H22N2O2 — CID 176980940
2,2,4,4-tetramethyl-6-oxoheptanehydrazide (PubChem CID 176980940) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-6-oxoheptanehydrazide.
| Compound Name | 2,2,4,4-tetramethyl-6-oxoheptanehydrazide |
|---|---|
| PubChem CID | 176980940 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2,2,4,4-tetramethyl-6-oxoheptanehydrazide |
| SMILES | CC(=O)CC(C)(C)CC(C)(C)C(=O)NN |
| InChI | InChI=1S/C11H22N2O2/c1-8(14)6-10(2,3)7-11(4,5)9(15)13-12/h6-7,12H2,1-5H3,(H,13,15) |
| InChIKey | QGUMGJOUFJFOFP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|