C13H19BN2O4 — CID 176980947
[[(2S)-3-phenyl-2-(propanoylamino)propanoyl]amino]methylboronic acid (PubChem CID 176980947) has the molecular formula C13H19BN2O4 and a molecular weight of 278.12 g/mol. Its IUPAC name is [[(2S)-3-phenyl-2-(propanoylamino)propanoyl]amino]methylboronic acid.
| Compound Name | [[(2S)-3-phenyl-2-(propanoylamino)propanoyl]amino]methylboronic acid |
|---|---|
| PubChem CID | 176980947 |
| Molecular Formula | C13H19BN2O4 |
| Molecular Weight | 278.12 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [[(2S)-3-phenyl-2-(propanoylamino)propanoyl]amino]methylboronic acid |
| SMILES | CCC(=O)N[C@@H](Cc1ccccc1)C(=O)NCB(O)O |
| InChI | InChI=1S/C13H19BN2O4/c1-2-12(17)16-11(13(18)15-9-14(19)20)8-10-6-4-3-5-7-10/h3-7,11,19-20H,2,8-9H2,1H3,(H,15,18)(H,16,17)/t11-/m0/s1 |
| InChIKey | JDLDTCGTTSTNIY-NSHDSACASA-N |
| XLogP | -0.75 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.12 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|