C32H43N5O2 — CID 176981300
ethane;15-[(4-methoxyphenyl)methyl]-4,12-dimethyl-1,9,13,15,25-pentazatetracyclo[18.3.1.110,14.02,7]pentacosa-2(7),3,5,10(25),11,13-hexaen-8-one (PubChem CID 176981300) has the molecular formula C32H43N5O2 and a molecular weight of 529.73 g/mol. Its IUPAC name is ethane;15-[(4-methoxyphenyl)methyl]-4,12-dimethyl-1,9,13,15,25-pentazatetracyclo[18.3.1.110,14.02,7]pentacosa-2(7),3,5,10(25),11,13-hexaen-8-one.
| Compound Name | ethane;15-[(4-methoxyphenyl)methyl]-4,12-dimethyl-1,9,13,15,25-pentazatetracyclo[18.3.1.110,14.02,7]pentacosa-2(7),3,5,10(25),11,13-hexaen-8-one |
|---|---|
| PubChem CID | 176981300 |
| Molecular Formula | C32H43N5O2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | ethane;15-[(4-methoxyphenyl)methyl]-4,12-dimethyl-1,9,13,15,25-pentazatetracyclo[18.3.1.110,14.02,7]pentacosa-2(7),3,5,10(25),11,13-hexaen-8-one |
| SMILES | CC.COc1ccc(CN2CCCCC3CCCN(C3)c3cc(C)ccc3C(=O)Nc3cc(C)nc2n3)cc1 |
| InChI | InChI=1S/C30H37N5O2.C2H6/c1-21-9-14-26-27(17-21)34-16-6-8-23(19-34)7-4-5-15-35(20-24-10-12-25(37-3)13-11-24)30-31-22(2)18-28(33-30)32-29(26)36;1-2/h9-14,17-18,23H,4-8,15-16,19-20H2,1-3H3,(H,31,32,33,36);1-2H3 |
| InChIKey | AEOVBRIYESRJLW-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |