C11H14N2O — CID 176981976
N-(4-propyl-2-pyridinyl)prop-2-enamide (PubChem CID 176981976) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is N-(4-propyl-2-pyridinyl)prop-2-enamide.
| Compound Name | N-(4-propyl-2-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 176981976 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-(4-propyl-2-pyridinyl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(CCC)ccn1 |
| InChI | InChI=1S/C11H14N2O/c1-3-5-9-6-7-12-10(8-9)13-11(14)4-2/h4,6-8H,2-3,5H2,1H3,(H,12,13,14) |
| InChIKey | OWPSMQZLOVXTMJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|