C25H28IN2O2- — CID 176982197
N-(2-propan-2-ylphenyl)-3-[[2-propan-2-yl-3-(prop-2-enoylamino)phenyl]methyliodanuidyl]prop-2-ynamide (PubChem CID 176982197) has the molecular formula C25H28IN2O2- and a molecular weight of 515.42 g/mol. Its IUPAC name is N-(2-propan-2-ylphenyl)-3-[[2-propan-2-yl-3-(prop-2-enoylamino)phenyl]methyliodanuidyl]prop-2-ynamide.
| Compound Name | N-(2-propan-2-ylphenyl)-3-[[2-propan-2-yl-3-(prop-2-enoylamino)phenyl]methyliodanuidyl]prop-2-ynamide |
|---|---|
| PubChem CID | 176982197 |
| Molecular Formula | C25H28IN2O2- |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | N-(2-propan-2-ylphenyl)-3-[[2-propan-2-yl-3-(prop-2-enoylamino)phenyl]methyliodanuidyl]prop-2-ynamide |
| SMILES | C=CC(=O)Nc1cccc(C[I-]C#CC(=O)Nc2ccccc2C(C)C)c1C(C)C |
| InChI | InChI=1S/C25H28IN2O2/c1-6-23(29)28-22-13-9-10-19(25(22)18(4)5)16-26-15-14-24(30)27-21-12-8-7-11-20(21)17(2)3/h6-13,17-18H,1,16H2,2-5H3,(H,27,30)(H,28,29)/q-1 |
| InChIKey | RPPWUFLVNKXIJL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|