C35H48N4O4 — CID 176982883
N-[3-(4-cyano-3-methoxyphenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[(3R,4R)-4-[(4-hydroxypiperidin-1-yl)methyl]-3-methylpiperidin-1-yl]benzamide (PubChem CID 176982883) has the molecular formula C35H48N4O4 and a molecular weight of 588.79 g/mol. Its IUPAC name is N-[3-(4-cyano-3-methoxyphenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[(3R,4R)-4-[(4-hydroxypiperidin-1-yl)methyl]-3-methylpiperidin-1-yl]benzamide.
| Compound Name | N-[3-(4-cyano-3-methoxyphenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[(3R,4R)-4-[(4-hydroxypiperidin-1-yl)methyl]-3-methylpiperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 176982883 |
| Molecular Formula | C35H48N4O4 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.37 |
| IUPAC Name | N-[3-(4-cyano-3-methoxyphenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[(3R,4R)-4-[(4-hydroxypiperidin-1-yl)methyl]-3-methylpiperidin-1-yl]benzamide |
| SMILES | COc1cc(OC2C(C)(C)C(NC(=O)c3ccc(N4CC[C@@H](CN5CCC(O)CC5)[C@@H](C)C4)cc3)C2(C)C)ccc1C#N |
| InChI | InChI=1S/C35H48N4O4/c1-23-21-39(18-13-26(23)22-38-16-14-28(40)15-17-38)27-10-7-24(8-11-27)31(41)37-32-34(2,3)33(35(32,4)5)43-29-12-9-25(20-36)30(19-29)42-6/h7-12,19,23,26,28,32-33,40H,13-18,21-22H2,1-6H3,(H,37,41)/t23-,26-,32?,33?/m0/s1 |
| InChIKey | FCYCUFXXLACBRG-DZWPRWSVSA-N |
| XLogP | 5.10 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |