C20H36N3O4V- — CID 176983595
N-[2-[2-[2-oxo-2-(4-propan-2-ylpiperidin-1-yl)ethoxy]ethoxy]ethyl]piperidin-1-ide-4-carboxamide;vanadium (PubChem CID 176983595) has the molecular formula C20H36N3O4V- and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[2-[2-[2-oxo-2-(4-propan-2-ylpiperidin-1-yl)ethoxy]ethoxy]ethyl]piperidin-1-ide-4-carboxamide;vanadium.
| Compound Name | N-[2-[2-[2-oxo-2-(4-propan-2-ylpiperidin-1-yl)ethoxy]ethoxy]ethyl]piperidin-1-ide-4-carboxamide;vanadium |
|---|---|
| PubChem CID | 176983595 |
| Molecular Formula | C20H36N3O4V- |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-[2-[2-[2-oxo-2-(4-propan-2-ylpiperidin-1-yl)ethoxy]ethoxy]ethyl]piperidin-1-ide-4-carboxamide;vanadium |
| SMILES | CC(C)C1CCN(C(=O)COCCOCCNC(=O)C2CC[N-]CC2)CC1.[V] |
| InChI | InChI=1S/C20H36N3O4.V/c1-16(2)17-5-10-23(11-6-17)19(24)15-27-14-13-26-12-9-22-20(25)18-3-7-21-8-4-18;/h16-18H,3-15H2,1-2H3,(H,22,25);/q-1; |
| InChIKey | DAUOSCVFBKBEBK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 81.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|