C19H38N2O — CID 176984732
ethane;1-(4-ethylpiperidin-1-yl)-2-(1-propan-2-ylpiperidin-4-yl)ethanone (PubChem CID 176984732) has the molecular formula C19H38N2O and a molecular weight of 310.53 g/mol. Its IUPAC name is ethane;1-(4-ethylpiperidin-1-yl)-2-(1-propan-2-ylpiperidin-4-yl)ethanone.
| Compound Name | ethane;1-(4-ethylpiperidin-1-yl)-2-(1-propan-2-ylpiperidin-4-yl)ethanone |
|---|---|
| PubChem CID | 176984732 |
| Molecular Formula | C19H38N2O |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.30 |
| IUPAC Name | ethane;1-(4-ethylpiperidin-1-yl)-2-(1-propan-2-ylpiperidin-4-yl)ethanone |
| SMILES | CC.CCC1CCN(C(=O)CC2CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C17H32N2O.C2H6/c1-4-15-5-11-19(12-6-15)17(20)13-16-7-9-18(10-8-16)14(2)3;1-2/h14-16H,4-13H2,1-3H3;1-2H3 |
| InChIKey | CGUQXFXUUXOBMV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |